| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:03 UTC |
|---|
| Update Date | 2025-03-25 00:46:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153599 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H24O12 |
|---|
| Molecular Mass | 480.1268 |
|---|
| SMILES | COc1ccc(CCC(=O)c2c(O)cc(O)cc2O)cc1OC1C(O)OC(C(=O)O)C(O)C1O |
|---|
| InChI Key | BZDDDYQBNNIVSX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | 2'-hydroxy-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl aryl ethersalkyl-phenylketonesanisolesaryl alkyl ketonesbenzoyl derivativesbeta hydroxy acids and derivativesbutyrophenonescarboxylic acidscinnamylphenolsglucuronic acid derivativeshemiacetalshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidssecondary alcoholsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidaryl alkyl ketonebenzoylmonosaccharidepyran carboxylic acidketonephloroglucinol derivativebeta-hydroxy acidsaccharidehemiacetaloxaneorganoheterocyclic compound1,2-diolacylphloroglucinol derivativealcoholbenzenetriolmethoxybenzenephenylketonevinylogous acidanisolephenolhydrocarbon derivativephenoxy compoundalkyl-phenylketonearyl ketonecarbonyl groupether2'-hydroxy-dihydrochalconeglucuronic acid or derivativesaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidcinnamylphenolalkyl aryl ethercarboxylic acid derivativeorganic oxidepyran carboxylic acid or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidbutyrophenoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholbenzenoidorganooxygen compound |
|---|