Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-21 14:39:03 UTC |
---|
Update Date | 2025-03-25 00:46:09 UTC |
---|
HMDB ID | HMDB0034992 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02153621 |
---|
Name | 4-Methoxybenzyl phenylacetate |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C16H16O3 |
---|
Molecular Mass | 256.1099 |
---|
SMILES | COc1ccc(COC(=O)Cc2ccccc2)cc1 |
---|
InChI Key | VCYWCSZLXMMLLE-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzyloxycarbonyls |
---|
Direct Parent | benzyloxycarbonyls |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alkyl aryl ethersanisolescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compounds |
---|
Substituents | benzyloxycarbonylphenol ethercarbonyl groupetheralkyl aryl ethercarboxylic acid derivativemethoxybenzenearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterhydrocarbon derivativephenoxy compoundorganooxygen compound |
---|