| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:03 UTC |
|---|
| Update Date | 2025-03-25 00:46:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153626 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13ClN2O6S |
|---|
| Molecular Mass | 360.0183 |
|---|
| SMILES | COc1ccc(CNc2cc(Cl)c(S(N)(=O)=O)cc2C(=O)O)o1 |
|---|
| InChI Key | ZLIXJZZKYFOVEO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds4-halobenzoic acidsalkyl aryl ethersamino acidsaminosulfonyl compoundsaryl chloridesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativeschlorobenzenesfuranshalobenzoic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganopnictogen compoundsorganosulfonamidesoxacyclic compoundsphenylalkylaminessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | carboxylic acidamino acid or derivativesorganochloridebenzoylorganonitrogen compound1-carboxy-2-haloaromatic compoundorganoheterocyclic compoundbenzenesulfonyl grouparyl chloridechlorobenzenevinylogous amidehalobenzoic acidbenzenesulfonamide4-halobenzoic acidheteroaromatic compoundsecondary aliphatic/aromatic aminearyl halide4-halobenzoic acid or derivativeshydrocarbon derivativehalobenzeneaminefuranorganosulfonic acid or derivativesetheraromatic heteromonocyclic compoundamino acidalkyl aryl etherorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideorganopnictogen compoundbenzoic acidaminosulfonyl compoundbenzoic acid or derivativeshalobenzoic acid or derivativessecondary amineoxacyclemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesphenylalkylamineorganic nitrogen compoundorganooxygen compound |
|---|