| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:08 UTC |
|---|
| Update Date | 2025-03-25 00:46:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153819 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H22O4 |
|---|
| Molecular Mass | 230.1518 |
|---|
| SMILES | CC(=O)CC1OC(C(O)O)C(C)C(C)C1C |
|---|
| InChI Key | XSKGYAPHHGCGRB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxanes |
|---|
| Subclass | oxanes |
|---|
| Direct Parent | oxanes |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl hydratesdialkyl ethershydrocarbon derivativesketonesorganic oxidesoxacyclic compounds |
|---|
| Substituents | carbonyl groupethercarbonyl hydratedialkyl etherketoneoxacycleorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundhydrocarbon derivativeoxaneorganooxygen compound |
|---|