| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:08 UTC |
|---|
| Update Date | 2025-03-25 00:46:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153831 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O2S |
|---|
| Molecular Mass | 280.1245 |
|---|
| SMILES | CS(=O)CCCCNC(=C=O)NCc1ccccc1 |
|---|
| InChI Key | JVKITACETWWTIX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | dialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundssulfinyl compoundssulfoxidesynolates |
|---|
| Substituents | secondary aliphatic aminemonocyclic benzene moietysecondary amineorganosulfur compoundaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundsulfinyl compoundynolateorganonitrogen compoundsulfoxideorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
