| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:11 UTC |
|---|
| Update Date | 2025-03-25 00:46:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153950 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O4 |
|---|
| Molecular Mass | 258.0892 |
|---|
| SMILES | COc1ccc2c3c1OC1C(O)C=CC4C(C2O)C341 |
|---|
| InChI Key | LYLPFETXBCQQJJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescoumaranshydrocarbon derivativesindanesoxacyclic compoundssecondary alcoholstetralins |
|---|
| Substituents | alcoholtetralinphenol etherphenanthreneetheralkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundanisoleindanesecondary alcoholhydrocarbon derivativeorganoheterocyclic compoundcoumaranorganooxygen compound |
|---|
