| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:15 UTC |
|---|
| Update Date | 2025-03-25 00:46:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154078 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12O6S |
|---|
| Molecular Mass | 260.0355 |
|---|
| SMILES | COc1cc(CC=O)ccc1OS(=O)(=O)OC |
|---|
| InChI Key | OYBRQPXCPKWLID-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalkyl sulfatesalpha-hydrogen aldehydesanisoleshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compoundsphenylacetaldehydessulfuric acid diesters |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraldehydealkyl aryl ethermethoxybenzenearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundsulfuric acid diesteralpha-hydrogen aldehydeanisolealkyl sulfatehydrocarbon derivativearylsulfatebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compoundphenylacetaldehyde |
|---|