| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:15 UTC |
|---|
| Update Date | 2025-03-25 00:46:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154108 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H18O8 |
|---|
| Molecular Mass | 374.1002 |
|---|
| SMILES | COc1cc(CC2CCC(=O)O2)cc(O)c1OC(=O)c1ccc(O)cc1O |
|---|
| InChI Key | RUGCDCKXQJTHDE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | depsides and depsidones |
|---|
| Subclass | depsides and depsidones |
|---|
| Direct Parent | depsides and depsidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzoyl derivativescarbonyl compoundscarboxylic acid estersdicarboxylic acids and derivativesgamma butyrolactoneshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesoxacyclic compoundsphenol estersphenoxy compoundsresorcinolssalicylic acid and derivativestetrahydrofuransvinylogous acidso-hydroxybenzoic acid estersp-hydroxybenzoic acid esters |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundp-hydroxybenzoic acid estermethoxyphenolbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoate esteralkyl aryl ethercarboxylic acid derivativeresorcinollactoneorganic oxideorganoheterocyclic compoundtetrahydrofuranbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidmethoxybenzenegamma butyrolactoneoxacyclevinylogous acidorganic oxygen compoundsalicylic acid or derivativeso-hydroxybenzoic acid esteranisolecarboxylic acid esterphenol esterdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidphenoxy compounddepside backboneorganooxygen compound |
|---|