| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:16 UTC |
|---|
| Update Date | 2025-03-25 00:46:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154132 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14N2O6S |
|---|
| Molecular Mass | 314.0573 |
|---|
| SMILES | COc1cc(CC2N=C(C)C(=O)N2)ccc1OS(=O)(=O)O |
|---|
| InChI Key | DBSWDRQTKFEYBS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesimidazolinonesketimineslactamsmethoxybenzenesorganic oxidesorganopnictogen compoundsphenoxy compoundspropargyl-type 1,3-dipolar organic compoundssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | phenol etherketiminemonocyclic benzene moietysulfuric acid monoestercarbonyl groupetherlactamaromatic heteromonocyclic compoundiminealkyl aryl ethercarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundphenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundimidazolinoneorganoheterocyclic compoundazacycleorganic 1,3-dipolar compoundcarboxamide groupmethoxybenzenesecondary carboxylic acid amideorganic oxygen compoundimidazolineanisole3-imidazolinesulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|