| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:17 UTC |
|---|
| Update Date | 2025-03-25 00:46:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154162 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21N3O4 |
|---|
| Molecular Mass | 331.1532 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OC3CCC(=O)NC3=O)cc2)CC1 |
|---|
| InChI Key | IZVJJDIBHKGVCN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acids and derivativesaminophenyl ethersaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdelta lactamsdialkylarylaminesdicarboximideshydrocarbon derivativesn-arylpiperazinesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compoundsphenoxy compoundspiperidinedionestertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl ethercarboxylic acid derivativecarboxylic acid imide, n-unsubstitutedorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinedionepiperidinonedicarboximidedialkylarylaminepiperidineaminophenyl ethertertiary amineacetamideazacycleaniline or substituted anilinescarboxamide groupcarboxylic acid imidephenylpiperazinedelta-lactamorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
