| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:17 UTC |
|---|
| Update Date | 2025-03-25 00:46:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154181 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H26N2O5 |
|---|
| Molecular Mass | 362.1842 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OCC3CCC(C(=O)O)OC3)cc2)CC1 |
|---|
| InChI Key | WFGRSARAVMYICK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acidsaminophenyl ethersaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acidsdialkyl ethersdialkylarylamineshydrocarbon derivativesmonocarboxylic acids and derivativesn-arylpiperazinesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidstertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidalkyl aryl ethercarboxylic acid derivativepyran carboxylic aciddialkyl etherorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundoxanedialkylarylamineaminophenyl ethertertiary amineacetamidepyran carboxylic acid or derivativesazacycleaniline or substituted anilinescarboxamide groupphenylpiperazineoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyranhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
