| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:18 UTC |
|---|
| Update Date | 2025-03-25 00:46:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154206 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H23N3O |
|---|
| Molecular Mass | 333.1841 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(Cc3c[nH]c4ccccc34)cc2)CC1 |
|---|
| InChI Key | YVARDFAGXHFLBM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesindolesn-arylpiperazinesorganic oxidesorganopnictogen compoundspyrrolestertiary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupamino acid or derivativesindolecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundtertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineacetamideazacycleaniline or substituted anilinesheteroaromatic compoundindole or derivativescarboxamide groupphenylpiperazineorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|
