Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:39:18 UTC |
---|
Update Date | 2025-03-25 00:46:15 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02154212 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C10H12N2O6S |
---|
Molecular Mass | 288.0416 |
---|
SMILES | COc1cc(S(N)(=O)=O)c(C(=O)O)cc1NC(C)=O |
---|
InChI Key | XBBVZLDTAICJKF-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | acylaminobenzoic acid and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compoundsacetamidesacetanilidesalkyl aryl ethersaminosulfonyl compoundsanisolesbenzenesulfonamidesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativescarbonyl compoundshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsorganosulfonamidesp-methoxybenzoic acids and derivativesphenoxy compoundssecondary carboxylic acid amides |
---|
Substituents | phenol etherorganosulfonic acid or derivativescarbonyl groupethercarboxylic acidn-acetylarylaminebenzoyln-arylamidealkyl aryl etherorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidacetamidebenzenesulfonyl groupacylaminobenzoic acid or derivativesbenzenesulfonamideaminosulfonyl compoundacetanilidecarboxamide groupmethoxybenzenearomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundp-methoxybenzoic acid or derivativesorganic sulfonic acid or derivativesanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
---|