Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:39:18 UTC |
---|
Update Date | 2025-03-25 00:46:15 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02154222 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C9H11ClN2O4S |
---|
Molecular Mass | 278.0128 |
---|
SMILES | COc1cc(Cl)c(NC(C)=O)cc1S(N)(=O)=O |
---|
InChI Key | STYQCVAABZCLQG-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | anilides |
---|
Direct Parent | o-haloacetanilides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | acetamidesalkyl aryl ethersaminosulfonyl compoundsanisolesaryl chloridesbenzenesulfonamidesbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesmethoxybenzenesn-acetylarylaminesorganic oxidesorganochloridesorganopnictogen compoundsorganosulfonamidesphenoxy compoundssecondary carboxylic acid amides |
---|
Substituents | phenol etherorganosulfonic acid or derivativescarbonyl groupethern-acetylarylamineorganochlorideo-haloacetaniliden-arylamidealkyl aryl etherorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidebenzenesulfonyl grouparyl chloridechlorobenzenebenzenesulfonamideaminosulfonyl compoundcarboxamide groupmethoxybenzenearyl halidearomatic homomonocyclic compoundsecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesanisolehydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compoundorganooxygen compound |
---|