| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:19 UTC |
|---|
| Update Date | 2025-03-25 00:46:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154266 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H33N3O4 |
|---|
| Molecular Mass | 427.2471 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(Oc3ccc(OCC(O)CNC(C)C)cc3)cc2)CC1 |
|---|
| InChI Key | HNHYKVZWBIHIMO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acids and derivativesaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylaminesdialkylarylaminesdiarylethershydrocarbon derivativesn-arylpiperazinesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundsphenylpiperazinessecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl ethercarboxylic acid derivativeorganic oxidepiperazinetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineorganoheterocyclic compoundacetamidealcoholsecondary aliphatic amineazacycleaniline or substituted anilinessecondary aminecarboxamide groupphenylpiperazineorganic oxygen compound1,4-diazinanesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compounddiphenyletheraminen-arylpiperazineorganooxygen compound |
|---|
