| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:21 UTC |
|---|
| Update Date | 2025-03-25 00:46:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154338 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12Br2O4 |
|---|
| Molecular Mass | 425.9102 |
|---|
| SMILES | COc1cc(C=CC(=O)O)ccc1Oc1ccc(Br)cc1Br |
|---|
| InChI Key | ZMTAHIAUDMPDRI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | bromodiphenyl ethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaryl bromidesbromobenzenescarbonyl compoundscarboxylic acidscinnamic acids and derivativesdiarylethershydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesorganobromidesphenoxy compounds |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acidbromodiphenyl etheralkyl aryl ethercarboxylic acid derivativeorganohalogen compoundcinnamic acid or derivativesorganic oxidebromobenzenemethoxybenzenearyl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundanisoleorganobromidehydrocarbon derivativehalobenzenephenoxy compoundaryl bromideorganooxygen compound |
|---|