| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:21 UTC |
|---|
| Update Date | 2025-03-25 00:46:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154347 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H17NO5 |
|---|
| Molecular Mass | 339.1107 |
|---|
| SMILES | COc1cc(C=CC(=O)CC(=O)C=Cc2ccc(O)nc2)ccc1O |
|---|
| InChI Key | GXGZENGWCGJQSG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-halopyridinesacryloyl compoundsalkyl aryl ethersanisolesazacyclic compoundsenonesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesketonesmethoxybenzenesmethoxyphenolsmethylpyridinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundspolyhalopyridines |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundpolyhalopyridine1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etheralpha,beta-unsaturated ketoneketoneorganic oxideorganonitrogen compoundorganopnictogen compound2-halopyridineorganoheterocyclic compoundenoneazacycleheteroaromatic compoundhydroxypyridinemethylpyridinemethoxybenzenehydroxycinnamic acidpyridineorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidacryloyl-grouporganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
