| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:22 UTC |
|---|
| Update Date | 2025-03-25 00:46:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154384 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11NO3S |
|---|
| Molecular Mass | 225.046 |
|---|
| SMILES | CC(=O)NC(=O)CSc1ccc(O)cc1 |
|---|
| InChI Key | VMRHOOKTTXPSSU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | thiophenols |
|---|
| Subclass | thiophenols |
|---|
| Direct Parent | thiophenols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesalkylarylthioethersbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfenyl compoundsthiophenol ethers |
|---|
| Substituents | monocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoidalkylarylthioetherorganosulfur compoundcarboxylic acid derivativearyl thioethercarboxylic acid imide, n-unsubstitutedorganic oxidethiophenolthiophenol etherorganonitrogen compoundorganopnictogen compounddicarboximideacetamidesulfenyl compoundcarboxylic acid imidearomatic homomonocyclic compoundorganic oxygen compoundthioetherphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|