Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:39:23 UTC |
---|
Update Date | 2025-03-25 00:46:17 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02154405 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C13H19NO8S |
---|
Molecular Mass | 349.0831 |
---|
SMILES | COc1cc(CC(O)CCC(=O)OCOS(N)(=O)=O)ccc1O |
---|
InChI Key | OKRDBXFWIMUHBA-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | phenols |
---|
Subclass | methoxyphenols |
---|
Direct Parent | methoxyphenols |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolescarbonyl compoundscarboxylic acid estersfatty acid estershydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganic sulfuric acids and derivativesphenoxy compoundssecondary alcohols |
---|
Substituents | fatty acylphenol ethermonocyclic benzene moietycarbonyl groupether1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl ethercarboxylic acid derivativeorganic oxidealcoholorganic sulfuric acid or derivativesmethoxybenzenearomatic homomonocyclic compoundfatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
---|