| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:25 UTC |
|---|
| Update Date | 2025-03-25 00:46:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154502 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H22O12 |
|---|
| Molecular Mass | 478.1111 |
|---|
| SMILES | COc1ccc(C2CC(=O)c3c(cc(O)cc3OC3OC(O)C(C(=O)O)C(O)C3O)O2)cc1O |
|---|
| InChI Key | AXDYOQGFGAQKML-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-o-methylated flavonoids7-hydroxyflavonoidsacetalsalkyl aryl ethersanisolesaryl alkyl ketonesbeta hydroxy acids and derivativescarboxylic acidschromonesflavanoneshemiacetalshydrocarbon derivativesmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidaryl alkyl ketone1-benzopyranflavanonemethoxyphenolmonosaccharideketonebeta-hydroxy acidsaccharideacetalchromonehemiacetaloxaneorganoheterocyclic compound1,2-diolalcoholbenzopyranmethoxybenzeneanisole7-hydroxyflavonoid4p-methoxyflavonoid-skeletonphenolhydrocarbon derivativephenoxy compoundaryl ketonecarbonyl groupetherflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundchromaneflavonoid-5-o-glycosidehydroxy acid1-hydroxy-4-unsubstituted benzenoidflavonoid o-glycoside3'-hydroxyflavonoidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholbenzenoidorganooxygen compound |
|---|