| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:26 UTC |
|---|
| Update Date | 2025-03-25 00:46:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154531 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H22O10 |
|---|
| Molecular Mass | 434.1213 |
|---|
| SMILES | COc1ccc(C2CC(=O)c3ccoc3C2)cc1OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | VKSZOKZCIGKNAD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersanisolesaryl alkyl ketonesbenzofuransbeta hydroxy acids and derivativescarboxylic acidsfuroic acid and derivativesglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | furanphenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaryl alkyl ketoneo-glucuronidemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acidketone1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundoxaneorganoheterocyclic compoundalcoholfuroic acid or derivativespyran carboxylic acid or derivativesbenzofuranheteroaromatic compoundhydroxy acidmethoxybenzeneoxacyclemonocarboxylic acid or derivativespyrananisolesecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundaryl ketone |
|---|