| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:27 UTC |
|---|
| Update Date | 2025-03-25 00:46:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154551 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H17NO4 |
|---|
| Molecular Mass | 311.1158 |
|---|
| SMILES | COc1ccc(C2C(=O)C(=O)N(C)C2c2ccc(O)cc2)cc1 |
|---|
| InChI Key | LFFOMKWACBZRLA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesazacyclic compoundscarboxylic acids and derivativescyclic ketoneshydrocarbon derivativeslactamsmethoxybenzenesn-alkylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsphenylpyrrolidinespyrrolespyrrolidine-2-onespyrrolidine-3-onestertiary carboxylic acid amides |
|---|
| Substituents | 2-pyrrolidonephenol ethermonocyclic benzene moietycarbonyl groupetherlactamaromatic heteromonocyclic compound3-pyrrolidone1-hydroxy-2-unsubstituted benzenoidcyclic ketonealkyl aryl ethercarboxylic acid derivativeketoneorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpyrrolidinepyrrolidoneorganoheterocyclic compoundazacyclen-alkylpyrrolidine2-phenylpyrrolidinecarboxamide groupmethoxybenzene3-phenylpyrrolidineorganic oxygen compoundanisolepyrrolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compoundstilbene |
|---|