| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:31 UTC |
|---|
| Update Date | 2025-03-25 00:46:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154719 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H12O7 |
|---|
| Molecular Mass | 340.0583 |
|---|
| SMILES | COc1ccc(-c2cc(O)cc3oc(C(=O)O)cc(=O)c3c2=O)cc1 |
|---|
| InChI Key | RURJCFVYMKUMBQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | cycloheptapyrans |
|---|
| Subclass | cycloheptapyrans |
|---|
| Direct Parent | cycloheptapyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarboxylic acidsheteroaromatic compoundsmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivativestropones |
|---|
| Substituents | phenol ethermonocyclic benzene moietyethertroponecarboxylic acidheteroaromatic compoundalkyl aryl ethercarboxylic acid derivativemethoxybenzenecycloheptapyranoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyrananisolepyranonehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|