| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:31 UTC |
|---|
| Update Date | 2025-03-25 00:46:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154740 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O7 |
|---|
| Molecular Mass | 316.0583 |
|---|
| SMILES | COc1cc2c(c3oc(=O)c4c(c13)OCO4)C1C(O)C=CC1O2 |
|---|
| InChI Key | DQNTUXGVKAIEHL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | furanocoumarins |
|---|
| Direct Parent | angular furanocoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransacetalsalkyl aryl ethersanisolescoumaransheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundspyranones and derivativessecondary alcoholsvinylogous esters |
|---|
| Substituents | phenol etherether1-benzopyranalkyl aryl etherlactoneorganic oxideacetalaromatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundcoumaranalcoholbenzopyranvinylogous esterheteroaromatic compoundangular furanocoumarinoxacycleorganic oxygen compoundpyrananisolesecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|