| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:32 UTC |
|---|
| Update Date | 2025-03-25 00:46:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154776 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H35N5O2S |
|---|
| Molecular Mass | 493.2511 |
|---|
| SMILES | CC(=O)N1CCN(CCOCCN2CCN(C3=Nc4ccccc4Sc4ccccc43)CC2)CC1 |
|---|
| InChI Key | QVAFRCHWRVMCOK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzothiazepines |
|---|
| Subclass | dibenzothiazepines |
|---|
| Direct Parent | dibenzothiazepines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesamidinesamino acids and derivativesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesdialkyl ethersdiarylthioethershydrocarbon derivativesimidolactamsn-alkylpiperazinesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupetheramino acid or derivativesamidinecarboxylic acid derivativearyl thioetherdialkyl etherpropargyl-type 1,3-dipolar organic compounddibenzothiazepineorganic oxidepiperazinearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundimidolactamtertiary amineacetamidediarylthioetherazacyclen-alkylpiperazinetertiary aliphatic amineorganic 1,3-dipolar compoundcarboxamide grouporganic oxygen compoundthioether1,4-diazinanehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|