| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:33 UTC |
|---|
| Update Date | 2025-03-25 00:46:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154791 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C35H45NO3 |
|---|
| Molecular Mass | 527.3399 |
|---|
| SMILES | COc1ccc(C(CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)C2(O)CCCCC2)cc1 |
|---|
| InChI Key | NPOXNTRIKWKVOD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaromatic alcoholsazacyclic compoundscyclic alcohols and derivativescyclohexanolshydrocarbon derivativesmethoxybenzenesorganopnictogen compoundsphenoxy compoundsphenylbutylaminespiperidinestertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholdiphenylmethanephenol etheretheraromatic heteromonocyclic compoundalkyl aryl etherphenylbutylamineorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic aminecyclohexanolcyclic alcoholmethoxybenzenetertiary alcoholorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|