| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:35 UTC |
|---|
| Update Date | 2025-03-25 00:46:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154871 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H16N2O5 |
|---|
| Molecular Mass | 340.1059 |
|---|
| SMILES | COc1ccc(C(C(=O)c2ccc(O)cc2O)C2=NCC(=O)N2)cc1 |
|---|
| InChI Key | ANIHFXCGCPZPDP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersalkyl-phenylketonesalpha amino acidsanisolesaryl alkyl ketonesazacyclic compoundsbenzoyl derivativescarboximidamidescarboxylic acids and derivativeshydrocarbon derivativesimidazolinonesmethoxybenzenesorganic oxidesorganopnictogen compoundsphenoxy compoundspropargyl-type 1,3-dipolar organic compoundsresorcinolsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraryl alkyl ketonearomatic heteromonocyclic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativesalkyl aryl ethercarboxylic acid derivativeresorcinolpropargyl-type 1,3-dipolar organic compoundketoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundimidazolinoneorganoheterocyclic compoundazacycleorganic 1,3-dipolar compoundcarboximidamide1-hydroxy-4-unsubstituted benzenoidmethoxybenzenephenylketonevinylogous acidorganic oxygen compound2-imidazolineanisoleimidazolinephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
|---|
