| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:36 UTC |
|---|
| Update Date | 2025-03-25 00:46:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154909 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18N2O7S |
|---|
| Molecular Mass | 358.0835 |
|---|
| SMILES | Cc1cc2ncn(C3OC(COS(=O)(=O)O)C(O)C3O)c2cc1C |
|---|
| InChI Key | OWSOIIXCGLZBJX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | benzimidazole ribonucleosides and ribonucleotides |
|---|
| Subclass | benzimidazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | benzimidazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl sulfatesazacyclic compoundsbenzenoidsbenzimidazolesheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholssulfuric acid monoesterstetrahydrofurans |
|---|
| Substituents | sulfuric acid monoestermonosaccharidesaccharideorganic oxidearomatic heteropolycyclic compoundbenzimidazoleimidazolealkyl sulfateorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholorganic sulfuric acid or derivativesazacycle1-ribofuranosylbenzimidazoletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|