| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:36 UTC |
|---|
| Update Date | 2025-03-25 00:46:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154930 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H26N2O5 |
|---|
| Molecular Mass | 398.1842 |
|---|
| SMILES | Cc1ccc(-c2nc3cc(C)c(C)cc3n2C2OC(CO)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | KMLWMAWFGMGDCS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | 1-pyranosylbenzimidazoles |
|---|
| Direct Parent | 1-pyranosylbenzimidazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenylbenzimidazolesphenylimidazolesprimary alcoholssecondary alcoholstoluenes |
|---|
| Substituents | monocyclic benzene moietymonosaccharidesaccharidearomatic heteropolycyclic compoundimidazolebenzimidazoleorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycleheteroaromatic compoundoxacycleorganic oxygen compound2-phenylimidazolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundtoluene1-pyranosylbenzimidazoleorganooxygen compoundphenylbenzimidazole |
|---|
