| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:37 UTC |
|---|
| Update Date | 2025-03-25 00:46:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154943 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15N3O |
|---|
| Molecular Mass | 229.1215 |
|---|
| SMILES | Cc1ccc(-c2c(N)cc(C(N)=O)n2C)cc1 |
|---|
| InChI Key | KIIQCRLMZFGGBI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrroles |
|---|
| Subclass | pyrrole carboxylic acids and derivatives |
|---|
| Direct Parent | pyrrole carboxamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidesamino acids and derivativesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesn-methylpyrrolesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminesprimary carboxylic acid amidessubstituted pyrrolestoluenes |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietyn-methylpyrrolearomatic heteromonocyclic compoundamino acid or derivativessubstituted pyrrolecarboxylic acid derivative2-heteroaryl carboxamideorganic oxideorganonitrogen compoundorganopnictogen compoundpyrrole-2-carboxamideazacycleheteroaromatic compoundcarboxamide grouporganic oxygen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundtolueneamineorganooxygen compound |
|---|
