| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:37 UTC |
|---|
| Update Date | 2025-03-25 00:46:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02154970 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O2 |
|---|
| Molecular Mass | 206.1307 |
|---|
| SMILES | Cc1cc2c(cc1O)CCC(O)C2(C)C |
|---|
| InChI Key | WHSVZFOQTRTFDI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | tetralins |
|---|
| Subclass | tetralins |
|---|
| Direct Parent | tetralins |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidshydrocarbon derivativessecondary alcohols |
|---|
| Substituents | alcoholtetralinorganic oxygen compoundsecondary alcohol1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundhydrocarbon derivativeorganooxygen compound |
|---|