| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:40 UTC |
|---|
| Update Date | 2025-03-25 00:46:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155059 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H22O2 |
|---|
| Molecular Mass | 282.162 |
|---|
| SMILES | Cc1ccc(C(C)C)c(OC(=O)CCc2ccccc2)c1 |
|---|
| InChI Key | UIAMPVMLJIBABC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | aromatic monoterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid esterscumenesfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesphenol estersphenoxy compoundsphenylpropanestoluenes |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidp-cymenecarboxylic acid derivativephenylpropanearomatic homomonocyclic compoundfatty acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenol estercumenehydrocarbon derivativebenzenoidphenoxy compoundtolueneorganooxygen compoundaromatic monoterpenoid |
|---|
