Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:39:42 UTC |
---|
Update Date | 2025-03-25 00:46:25 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02155166 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C10H13NO4S |
---|
Molecular Mass | 243.0565 |
---|
SMILES | Cc1cc(C(C)C(=O)O)ccc1S(N)(=O)=O |
---|
InChI Key | UUCYRBKYXOELPO-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | phenylpropanoic acids |
---|
Subclass | phenylpropanoic acids |
---|
Direct Parent | phenylpropanoic acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | aminosulfonyl compoundsbenzenesulfonamidesbenzenesulfonyl compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganosulfonamidestoluenes |
---|
Substituents | organosulfonic acid or derivativesmonocyclic benzene moietycarbonyl groupbenzenesulfonamidecarboxylic acidaminosulfonyl compoundorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amidearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compound2-phenylpropanoic-acidorganic sulfonic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundtolueneorganooxygen compoundbenzenesulfonyl group |
---|