| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:43 UTC |
|---|
| Update Date | 2025-03-25 00:46:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155196 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14O3 |
|---|
| Molecular Mass | 218.0943 |
|---|
| SMILES | Cc1cc2c(cc1C(=O)C(=O)O)CCCC2 |
|---|
| InChI Key | RUDFBMVNXNXLFC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | tetralins |
|---|
| Subclass | tetralins |
|---|
| Direct Parent | tetralins |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha-keto acids and derivativesaryl ketonescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | tetralincarbonyl groupcarboxylic acidaromatic homopolycyclic compoundcarboxylic acid derivativeketoneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundketo acidalpha-keto acidhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
