| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:44 UTC |
|---|
| Update Date | 2025-03-25 00:46:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155211 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H34 |
|---|
| Molecular Mass | 286.2661 |
|---|
| SMILES | Cc1cc2c(c(C)c1C(C)(C)C)C(C)(C)CC(C)C2(C)C |
|---|
| InChI Key | CDTLTWCDDUFDTO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | tetralins |
|---|
| Subclass | tetralins |
|---|
| Direct Parent | tetralins |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | polycyclic hydrocarbonssaturated hydrocarbons |
|---|
| Substituents | tetralinsaturated hydrocarbonaromatic homopolycyclic compoundpolycyclic hydrocarbonhydrocarbon |
|---|