| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:45 UTC |
|---|
| Update Date | 2025-03-25 00:46:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155274 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H30O10 |
|---|
| Molecular Mass | 502.1839 |
|---|
| SMILES | Cc1cc2c(CCC(=O)O)c(CCC(=O)O)c(CCC(=O)O)c(CCC(=O)O)c2cc1CCC(=O)O |
|---|
| InChI Key | HLAFVNHICSUMEB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | pentacarboxylic acids and derivatives |
|---|
| Direct Parent | pentacarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesnaphthalenesorganic oxides |
|---|
| Substituents | carbonyl grouporganic oxidenaphthalenecarboxylic acidorganic oxygen compoundaromatic homopolycyclic compoundhydrocarbon derivativebenzenoidpentacarboxylic acid or derivativesorganooxygen compound |
|---|
