| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:47 UTC |
|---|
| Update Date | 2025-03-25 00:46:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155340 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N2O10S |
|---|
| Molecular Mass | 368.0526 |
|---|
| SMILES | Cc1cn(C2OC(COS(=O)(=O)O)C(O)C(O)C2O)c(=O)[nH]c1=O |
|---|
| InChI Key | PZSPVGSCSGOPFD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssulfuric acid monoestersvinylogous amides |
|---|
| Substituents | sulfuric acid monoesterlactamaromatic heteromonocyclic compoundmonosaccharidepyrimidonesaccharideorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundoxanealcoholvinylogous amidecarbonic acid derivativeorganic sulfuric acid or derivativesazacycleheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
