| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:48 UTC |
|---|
| Update Date | 2025-03-25 00:46:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155377 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N2O3S |
|---|
| Molecular Mass | 282.1038 |
|---|
| SMILES | Cc1ccccc1S(=O)(=O)N1CCC(C(N)=O)CC1 |
|---|
| InChI Key | OOLLVJZPWSUXEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidespiperidinecarboxamidespiperidinesprimary carboxylic acid amidessulfonylstoluenes |
|---|
| Substituents | primary carboxylic acid amideorganosulfonic acid or derivativescarbonyl grouparomatic heteromonocyclic compoundorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidineorganoheterocyclic compoundbenzenesulfonyl groupbenzenesulfonamideazacyclepiperidinecarboxamidecarboxamide groupsulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundtolueneorganooxygen compound |
|---|
