| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:48 UTC |
|---|
| Update Date | 2025-03-25 00:46:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155386 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H32N2O5 |
|---|
| Molecular Mass | 452.2311 |
|---|
| SMILES | Cc1ccccc1NC(=O)c1c(C(C)C)n(CCC(O)CC(O)CC(=O)O)c2ccccc12 |
|---|
| InChI Key | ANRVFERFDDMDQX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | aromatic anilides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino fatty acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundsheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsindolecarboxamides and derivativesindolesmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesmonocarboxylic acids and derivativesn-alkylindolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrole carboxamidessecondary alcoholssecondary carboxylic acid amidessubstituted pyrrolestoluenesvinylogous amides |
|---|
| Substituents | fatty acylcarbonyl groupn-alkylindoleindolecarboxamide derivativecarboxylic acidpyrrole-3-carboxylic acid or derivativesheterocyclic fatty acidindolefatty acidsubstituted pyrrolecarboxylic acid derivativemedium-chain hydroxy acidaromatic anilidebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundpyrrole-3-carboxamideorganopnictogen compoundmedium-chain fatty acidhydroxy fatty acidorganoheterocyclic compoundindolecarboxylic acid derivativealcoholvinylogous amideazacycleheteroaromatic compoundindole or derivativeshydroxy acidcarboxamide groupamino fatty acidsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundpyrrolesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundtolueneorganooxygen compound |
|---|
