| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:48 UTC |
|---|
| Update Date | 2025-03-25 00:46:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155388 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N2O2S |
|---|
| Molecular Mass | 254.1089 |
|---|
| SMILES | Cc1ccccc1N1CCN(S(C)(=O)=O)CC1 |
|---|
| InChI Key | PXNZRLHRRHMURW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminotoluenesaniline and substituted anilinesazacyclic compoundsdialkylarylamineshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganic sulfonamidesorganopnictogen compoundsorganosulfonamidessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietyaromatic heteromonocyclic compoundorganosulfur compoundorganosulfonic acid amideorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineaminotolueneazacycleaniline or substituted anilinesphenylpiperazinesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganic sulfonic acid amidetolueneaminen-arylpiperazine |
|---|