| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:52 UTC |
|---|
| Update Date | 2025-03-25 00:46:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155521 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22O |
|---|
| Molecular Mass | 218.1671 |
|---|
| SMILES | CC(=O)C(C)C(C)c1cccc(C(C)C)c1 |
|---|
| InChI Key | VEMVRPGYFPXZEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | cumenes |
|---|
| Direct Parent | cumenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesketonesorganic oxidesphenylpropanes |
|---|
| Substituents | ketonephenylpropanearomatic homomonocyclic compoundcarbonyl grouporganic oxideorganic oxygen compoundcumenehydrocarbon derivativeorganooxygen compound |
|---|