| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:52 UTC |
|---|
| Update Date | 2025-03-25 00:46:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155532 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H19NO2 |
|---|
| Molecular Mass | 221.1416 |
|---|
| SMILES | Cc1ccc2c(c1)OC(CN(C)C)C(C)O2 |
|---|
| InChI Key | VAGSCWBYSPFDGL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzodioxanes |
|---|
| Subclass | benzo-1,4-dioxanes |
|---|
| Direct Parent | benzo-1,4-dioxanes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersbenzenoidshydrocarbon derivativesorganopnictogen compoundsoxacyclic compoundspara dioxinstrialkylamines |
|---|
| Substituents | benzo-1,4-dioxaneethertertiary aliphatic aminealkyl aryl etheroxacycleorganic oxygen compoundpara-dioxinaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|