| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:55 UTC |
|---|
| Update Date | 2025-03-25 00:46:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155639 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21N3O5 |
|---|
| Molecular Mass | 347.1481 |
|---|
| SMILES | Cc1cccc(C)c1NCC1OC(n2ccc(=O)[nH]c2=O)C(O)C1O |
|---|
| InChI Key | OGMROMNRRWNROX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | 5'-deoxyribonucleosides |
|---|
| Subclass | 5'-deoxyribonucleosides |
|---|
| Direct Parent | 5'-deoxyribonucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenylalkylaminespyrimidonessecondary alcoholssecondary alkylarylaminestetrahydrofuransvinylogous amidesm-xylenes |
|---|
| Substituents | monocyclic benzene moietylactamaromatic heteromonocyclic compoundmonosaccharidepyrimidonepyrimidinexylenesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compound1,2-diolalcoholvinylogous amide5'-deoxyribonucleosidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundm-xylenesecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundsecondary alcoholphenylalkylaminehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
