Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:39:57 UTC |
---|
Update Date | 2025-03-25 00:46:32 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02155706 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C19H15F17N2O3S |
---|
Molecular Mass | 674.0532 |
---|
SMILES | Cc1cccc(C)c1NC(=O)CN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
---|
InChI Key | BRQGGXPXYNZUDT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organohalogen compounds |
---|
Class | alkyl halides |
---|
Subclass | alkyl fluorides |
---|
Direct Parent | perfluorooctane sulfonic acid and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alkyl fluoridesalpha amino acidsaminosulfonyl compoundsanilidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganic sulfonamidesorganofluoridesorganopnictogen compoundsorganosulfonamidessecondary carboxylic acid amidesm-xylenes |
---|
Substituents | organosulfonic acid or derivativesmonocyclic benzene moietycarbonyl groupn-arylamidealpha-amino acid or derivativesorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amidexyleneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundperfluorooctane sulfonic acid or derivativesaminosulfonyl compoundorganofluoridem-xylenecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganic sulfonic acid amideorganooxygen compound |
---|