| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:57 UTC |
|---|
| Update Date | 2025-03-25 00:46:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155734 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6N4O3S |
|---|
| Molecular Mass | 226.0161 |
|---|
| SMILES | CSc1nc2c(=O)[nH]c(=O)[nH]c2[nH]c1=O |
|---|
| InChI Key | GRARUNKUSJDMDD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkylarylthioethersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrazinespyrimidonessulfenyl compoundsvinylogous amides |
|---|
| Substituents | vinylogous amidecarbonic acid derivativelactamsulfenyl compoundazacycleheteroaromatic compoundpyrimidonealkylarylthioetherorganosulfur compoundpteridinearyl thioetherpyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundthioetherpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
