| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:58 UTC |
|---|
| Update Date | 2025-03-25 00:46:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155751 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6N4OS2 |
|---|
| Molecular Mass | 213.9983 |
|---|
| SMILES | CSSc1nc2nc[nH]c2c(=O)[nH]1 |
|---|
| InChI Key | HZNPUIALCTZZNS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsorganic disulfidesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspurines and purine derivativespyrimidonessulfenyl compounds |
|---|
| Substituents | lactamsulfenyl compoundazacycleheteroaromatic compoundpyrimidoneorganosulfur compoundpyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganic disulfideorganonitrogen compoundorganopnictogen compoundhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundazole |
|---|
