| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:01 UTC |
|---|
| Update Date | 2025-03-25 00:46:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155851 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H20NO3+ |
|---|
| Molecular Mass | 190.1438 |
|---|
| SMILES | C[N+](C)(C)CC1(O)CC(O)C(O)C1 |
|---|
| InChI Key | FDBDYPYNEVQYJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclopentanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsaminescyclitols and derivativeshydrocarbon derivativesorganic cationsorganic saltsorganopnictogen compoundstertiary alcoholstetraalkylammonium salts |
|---|
| Substituents | tetraalkylammonium salt1,2-aminoalcoholquaternary ammonium saltcyclitol or derivativescyclic alcoholcyclopentanoltertiary alcoholorganonitrogen compoundaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamine |
|---|
