| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:01 UTC |
|---|
| Update Date | 2025-03-25 00:46:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155853 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H26NO3+ |
|---|
| Molecular Mass | 268.1907 |
|---|
| SMILES | C[N+](C)(C)CC(O)CC(O)CCc1ccc(O)cc1 |
|---|
| InChI Key | TVXYLPYZPAOQEN-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | cholines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcohols1-hydroxy-2-unsubstituted benzenoidsaminesbenzene and substituted derivativeshydrocarbon derivativesorganic cationsorganic saltsorganopnictogen compoundssecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | alcoholmonocyclic benzene moietytetraalkylammonium salt1,2-aminoalcohol1-hydroxy-2-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxygen compoundcholinesecondary alcoholorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic cationorganic saltamineorganooxygen compound |
|---|