Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:40:01 UTC |
---|
Update Date | 2025-03-25 00:46:33 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02155870 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C19H24NO5+ |
---|
Molecular Mass | 346.1649 |
---|
SMILES | C[N+](C)(C)CC(Cc1ccc(O)c(O)c1)OC(=O)c1ccccc1O |
---|
InChI Key | FQMJOSZWKQXGPM-UHFFFAOYSA-O |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | o-hydroxybenzoic acid esters |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaminesbenzoyl derivativescarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganooxygen compoundsorganopnictogen compoundssalicylic acid and derivativestetraalkylammonium saltsvinylogous acids |
---|
Substituents | benzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic salttetraalkylammonium saltquaternary ammonium salt1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativeso-hydroxybenzoic acid estercarboxylic acid esterphenolhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
---|