| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:40:02 UTC |
|---|
| Update Date | 2025-03-25 00:46:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02155911 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H23N4O6+ |
|---|
| Molecular Mass | 319.1612 |
|---|
| SMILES | C[N+](C)(C)C(CCNC(=N)NC(CC(=O)O)C(=O)O)C(=O)O |
|---|
| InChI Key | UVBQWVGNTOALFE-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaminescarbonyl compoundscarboximidamidescarboxylic acidsguanidineshydrocarbon derivativesiminesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstetraalkylammonium saltstricarboxylic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidtetraalkylammonium saltguanidineiminequaternary ammonium salttricarboxylic acid or derivativescarboximidamideorganic oxideorganic oxygen compoundalpha-amino acidaspartic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|